C10H17BO6 — CID 539019
(2-ethyl-4-methoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxaborol-6-yl)methyl acetate (PubChem CID 539019) has the molecular formula C10H17BO6 and a molecular weight of 244.05 g/mol. Its IUPAC name is (2-ethyl-4-methoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxaborol-6-yl)methyl acetate.
| Compound Name | (2-ethyl-4-methoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxaborol-6-yl)methyl acetate |
|---|---|
| PubChem CID | 539019 |
| Molecular Formula | C10H17BO6 |
| Molecular Weight | 244.05 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | (2-ethyl-4-methoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxaborol-6-yl)methyl acetate |
| SMILES | CCB1OC2C(COC(C)=O)OC(OC)C2O1 |
| InChI | InChI=1S/C10H17BO6/c1-4-11-16-8-7(5-14-6(2)12)15-10(13-3)9(8)17-11/h7-10H,4-5H2,1-3H3 |
| InChIKey | FIEJCUZEOZIFTB-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.05 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|