C21H24N2O8S — CID 91691887
[2-[[(4-acetamidophenyl)sulfonyl-methylamino]methyl]-4-acetyloxy-5-methoxyphenyl] acetate (PubChem CID 91691887) has the molecular formula C21H24N2O8S and a molecular weight of 464.50 g/mol. Its IUPAC name is [2-[[(4-acetamidophenyl)sulfonyl-methylamino]methyl]-4-acetyloxy-5-methoxyphenyl] acetate.
| Compound Name | [2-[[(4-acetamidophenyl)sulfonyl-methylamino]methyl]-4-acetyloxy-5-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 91691887 |
| Molecular Formula | C21H24N2O8S |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | [2-[[(4-acetamidophenyl)sulfonyl-methylamino]methyl]-4-acetyloxy-5-methoxyphenyl] acetate |
| SMILES | COc1cc(OC(C)=O)c(CN(C)S(=O)(=O)c2ccc(NC(C)=O)cc2)cc1OC(C)=O |
| InChI | InChI=1S/C21H24N2O8S/c1-13(24)22-17-6-8-18(9-7-17)32(27,28)23(4)12-16-10-21(31-15(3)26)20(29-5)11-19(16)30-14(2)25/h6-11H,12H2,1-5H3,(H,22,24) |
| InChIKey | IGNQQDQLXKJCFO-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|