About but-3-enyl pentadecyl carbonate
but-3-enyl pentadecyl carbonate (PubChem CID 91692457) has the molecular formula C20H38O3
and a molecular weight of 326.52 g/mol. Its IUPAC name is but-3-enyl pentadecyl carbonate.
Molecular Properties
| Compound Name | but-3-enyl pentadecyl carbonate |
| PubChem CID | 91692457 |
| Molecular Formula | C20H38O3 |
| Molecular Weight | 326.52 g/mol |
| Exact Mass | 326.28 |
| IUPAC Name | but-3-enyl pentadecyl carbonate |
| SMILES | C=CCCOC(=O)OCCCCCCCCCCCCCCC |
| InChI | InChI=1S/C20H38O3/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-19-23-20(21)22-18-6-4-2/h4H,2-3,5-19H2,1H3 |
| InChIKey | RLDBHLGVCSHTCE-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.52 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze but-3-enyl pentadecyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-enyl pentadecyl carbonate?
The IUPAC name of but-3-enyl pentadecyl carbonate (CID 91692457) is but-3-enyl pentadecyl carbonate.
What is the SMILES notation for but-3-enyl pentadecyl carbonate?
The canonical SMILES for but-3-enyl pentadecyl carbonate is C=CCCOC(=O)OCCCCCCCCCCCCCCC.
What is the InChIKey of but-3-enyl pentadecyl carbonate?
The InChIKey is RLDBHLGVCSHTCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H38O3/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-19-23-20(21)22-18-6-4-2/h4H,2-3,5-19H2,1H3.
What are the key properties of but-3-enyl pentadecyl carbonate?
but-3-enyl pentadecyl carbonate has a molecular weight of 326.52 g/mol, XLogP of 6.81, 17 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-enyl pentadecyl carbonate is sourced from PubChem (CID 91692457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).