C12H16F4O4 — CID 91694490
1-O-(3-methylbut-3-enyl) 4-O-(2,2,3,3-tetrafluoropropyl) butanedioate (PubChem CID 91694490) has the molecular formula C12H16F4O4 and a molecular weight of 300.25 g/mol. Its IUPAC name is 1-O-(3-methylbut-3-enyl) 4-O-(2,2,3,3-tetrafluoropropyl) butanedioate.
| Compound Name | 1-O-(3-methylbut-3-enyl) 4-O-(2,2,3,3-tetrafluoropropyl) butanedioate |
|---|---|
| PubChem CID | 91694490 |
| Molecular Formula | C12H16F4O4 |
| Molecular Weight | 300.25 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 1-O-(3-methylbut-3-enyl) 4-O-(2,2,3,3-tetrafluoropropyl) butanedioate |
| SMILES | C=C(C)CCOC(=O)CCC(=O)OCC(F)(F)C(F)F |
| InChI | InChI=1S/C12H16F4O4/c1-8(2)5-6-19-9(17)3-4-10(18)20-7-12(15,16)11(13)14/h11H,1,3-7H2,2H3 |
| InChIKey | HMYRORONEVDNIH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.25 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|