C12H17F3O4 — CID 91694487
1-O-(3-methylbut-3-enyl) 4-O-(1,1,1-trifluoropropan-2-yl) butanedioate (PubChem CID 91694487) has the molecular formula C12H17F3O4 and a molecular weight of 282.26 g/mol. Its IUPAC name is 1-O-(3-methylbut-3-enyl) 4-O-(1,1,1-trifluoropropan-2-yl) butanedioate.
| Compound Name | 1-O-(3-methylbut-3-enyl) 4-O-(1,1,1-trifluoropropan-2-yl) butanedioate |
|---|---|
| PubChem CID | 91694487 |
| Molecular Formula | C12H17F3O4 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 1-O-(3-methylbut-3-enyl) 4-O-(1,1,1-trifluoropropan-2-yl) butanedioate |
| SMILES | C=C(C)CCOC(=O)CCC(=O)OC(C)C(F)(F)F |
| InChI | InChI=1S/C12H17F3O4/c1-8(2)6-7-18-10(16)4-5-11(17)19-9(3)12(13,14)15/h9H,1,4-7H2,2-3H3 |
| InChIKey | TZBDGRBURWLXSE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|