C16H26Cl2O4 — CID 91694519
1-O-[(E)-dec-4-enyl] 4-O-(2,2-dichloroethyl) butanedioate (PubChem CID 91694519) has the molecular formula C16H26Cl2O4 and a molecular weight of 353.29 g/mol. Its IUPAC name is 1-O-[(E)-dec-4-enyl] 4-O-(2,2-dichloroethyl) butanedioate.
| Compound Name | 1-O-[(E)-dec-4-enyl] 4-O-(2,2-dichloroethyl) butanedioate |
|---|---|
| PubChem CID | 91694519 |
| Molecular Formula | C16H26Cl2O4 |
| Molecular Weight | 353.29 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 1-O-[(E)-dec-4-enyl] 4-O-(2,2-dichloroethyl) butanedioate |
| SMILES | CCCCC/C=C/CCCOC(=O)CCC(=O)OCC(Cl)Cl |
| InChI | InChI=1S/C16H26Cl2O4/c1-2-3-4-5-6-7-8-9-12-21-15(19)10-11-16(20)22-13-14(17)18/h6-7,14H,2-5,8-13H2,1H3/b7-6+ |
| InChIKey | OWWFYFLISFJSOA-VOTSOKGWSA-N |
| XLogP | 4.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.29 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|