C16H24Cl2O4 — CID 91695030
4-O-(2,2-dichloroethyl) 1-O-[(2E)-3,7-dimethylocta-2,6-dienyl] butanedioate (PubChem CID 91695030) has the molecular formula C16H24Cl2O4 and a molecular weight of 351.27 g/mol. Its IUPAC name is 4-O-(2,2-dichloroethyl) 1-O-[(2E)-3,7-dimethylocta-2,6-dienyl] butanedioate.
| Compound Name | 4-O-(2,2-dichloroethyl) 1-O-[(2E)-3,7-dimethylocta-2,6-dienyl] butanedioate |
|---|---|
| PubChem CID | 91695030 |
| Molecular Formula | C16H24Cl2O4 |
| Molecular Weight | 351.27 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 4-O-(2,2-dichloroethyl) 1-O-[(2E)-3,7-dimethylocta-2,6-dienyl] butanedioate |
| SMILES | CC(C)=CCC/C(C)=C/COC(=O)CCC(=O)OCC(Cl)Cl |
| InChI | InChI=1S/C16H24Cl2O4/c1-12(2)5-4-6-13(3)9-10-21-15(19)7-8-16(20)22-11-14(17)18/h5,9,14H,4,6-8,10-11H2,1-3H3/b13-9+ |
| InChIKey | OLLMSDFYNCTPLD-UKTHLTGXSA-N |
| XLogP | 4.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.27 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|