C17H26Cl2O4 — CID 91694949
5-O-(2,2-dichloroethyl) 1-O-[(2Z)-3,7-dimethylocta-2,6-dienyl] pentanedioate (PubChem CID 91694949) has the molecular formula C17H26Cl2O4 and a molecular weight of 365.30 g/mol. Its IUPAC name is 5-O-(2,2-dichloroethyl) 1-O-[(2Z)-3,7-dimethylocta-2,6-dienyl] pentanedioate.
| Compound Name | 5-O-(2,2-dichloroethyl) 1-O-[(2Z)-3,7-dimethylocta-2,6-dienyl] pentanedioate |
|---|---|
| PubChem CID | 91694949 |
| Molecular Formula | C17H26Cl2O4 |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 5-O-(2,2-dichloroethyl) 1-O-[(2Z)-3,7-dimethylocta-2,6-dienyl] pentanedioate |
| SMILES | CC(C)=CCC/C(C)=C\COC(=O)CCCC(=O)OCC(Cl)Cl |
| InChI | InChI=1S/C17H26Cl2O4/c1-13(2)6-4-7-14(3)10-11-22-16(20)8-5-9-17(21)23-12-15(18)19/h6,10,15H,4-5,7-9,11-12H2,1-3H3/b14-10- |
| InChIKey | LYBSPZYUCDKQRH-UVTDQMKNSA-N |
| XLogP | 4.74 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|