C20H32O4 — CID 91694684
5-O-[(2E)-3,7-dimethylocta-2,6-dienyl] 1-O-(3-methylbut-2-enyl) pentanedioate (PubChem CID 91694684) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is 5-O-[(2E)-3,7-dimethylocta-2,6-dienyl] 1-O-(3-methylbut-2-enyl) pentanedioate.
| Compound Name | 5-O-[(2E)-3,7-dimethylocta-2,6-dienyl] 1-O-(3-methylbut-2-enyl) pentanedioate |
|---|---|
| PubChem CID | 91694684 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | 5-O-[(2E)-3,7-dimethylocta-2,6-dienyl] 1-O-(3-methylbut-2-enyl) pentanedioate |
| SMILES | CC(C)=CCC/C(C)=C/COC(=O)CCCC(=O)OCC=C(C)C |
| InChI | InChI=1S/C20H32O4/c1-16(2)8-6-9-18(5)13-15-24-20(22)11-7-10-19(21)23-14-12-17(3)4/h8,12-13H,6-7,9-11,14-15H2,1-5H3/b18-13+ |
| InChIKey | VCOHZZNXGZGPPW-QGOAFFKASA-N |
| XLogP | 4.90 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|