C19H28O4 — CID 91694963
5-O-but-3-yn-2-yl 1-O-[(2Z)-3,7-dimethylocta-2,6-dienyl] pentanedioate (PubChem CID 91694963) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is 5-O-but-3-yn-2-yl 1-O-[(2Z)-3,7-dimethylocta-2,6-dienyl] pentanedioate.
| Compound Name | 5-O-but-3-yn-2-yl 1-O-[(2Z)-3,7-dimethylocta-2,6-dienyl] pentanedioate |
|---|---|
| PubChem CID | 91694963 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 5-O-but-3-yn-2-yl 1-O-[(2Z)-3,7-dimethylocta-2,6-dienyl] pentanedioate |
| SMILES | C#CC(C)OC(=O)CCCC(=O)OC/C=C(/C)CCC=C(C)C |
| InChI | InChI=1S/C19H28O4/c1-6-17(5)23-19(21)12-8-11-18(20)22-14-13-16(4)10-7-9-15(2)3/h1,9,13,17H,7-8,10-12,14H2,2-5H3/b16-13- |
| InChIKey | XXNPMTKPQJVNKJ-SSZFMOIBSA-N |
| XLogP | 3.96 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|