C11H13F8NO3 — CID 91695196
2,2,3,3,3-pentafluoropropyl 3-methyl-2-[(2,2,2-trifluoroacetyl)amino]pentanoate (PubChem CID 91695196) has the molecular formula C11H13F8NO3 and a molecular weight of 359.21 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoropropyl 3-methyl-2-[(2,2,2-trifluoroacetyl)amino]pentanoate.
| Compound Name | 2,2,3,3,3-pentafluoropropyl 3-methyl-2-[(2,2,2-trifluoroacetyl)amino]pentanoate |
|---|---|
| PubChem CID | 91695196 |
| Molecular Formula | C11H13F8NO3 |
| Molecular Weight | 359.21 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 2,2,3,3,3-pentafluoropropyl 3-methyl-2-[(2,2,2-trifluoroacetyl)amino]pentanoate |
| SMILES | CCC(C)C(NC(=O)C(F)(F)F)C(=O)OCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H13F8NO3/c1-3-5(2)6(20-8(22)10(14,15)16)7(21)23-4-9(12,13)11(17,18)19/h5-6H,3-4H2,1-2H3,(H,20,22) |
| InChIKey | VFODLROYLQBXDL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.21 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|