C16H28O6 — CID 91695685
1-O-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl] 3-O-ethyl 2,2-diethylpropanedioate (PubChem CID 91695685) has the molecular formula C16H28O6 and a molecular weight of 316.39 g/mol. Its IUPAC name is 1-O-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl] 3-O-ethyl 2,2-diethylpropanedioate.
| Compound Name | 1-O-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl] 3-O-ethyl 2,2-diethylpropanedioate |
|---|---|
| PubChem CID | 91695685 |
| Molecular Formula | C16H28O6 |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 1-O-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl] 3-O-ethyl 2,2-diethylpropanedioate |
| SMILES | CCOC(=O)C(CC)(CC)C(=O)OCCC1COC(C)(C)O1 |
| InChI | InChI=1S/C16H28O6/c1-6-16(7-2,13(17)19-8-3)14(18)20-10-9-12-11-21-15(4,5)22-12/h12H,6-11H2,1-5H3 |
| InChIKey | DSEMECMSXHKNGY-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|