C20H44N2Si4 — CID 91696857
1-[3-[[bis(trimethylsilyl)amino]methyl]phenyl]-N,N-bis(trimethylsilyl)methanamine (PubChem CID 91696857) has the molecular formula C20H44N2Si4 and a molecular weight of 424.93 g/mol. Its IUPAC name is 1-[3-[[bis(trimethylsilyl)amino]methyl]phenyl]-N,N-bis(trimethylsilyl)methanamine.
| Compound Name | 1-[3-[[bis(trimethylsilyl)amino]methyl]phenyl]-N,N-bis(trimethylsilyl)methanamine |
|---|---|
| PubChem CID | 91696857 |
| Molecular Formula | C20H44N2Si4 |
| Molecular Weight | 424.93 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | 1-[3-[[bis(trimethylsilyl)amino]methyl]phenyl]-N,N-bis(trimethylsilyl)methanamine |
| SMILES | C[Si](C)(C)N(Cc1cccc(CN([Si](C)(C)C)[Si](C)(C)C)c1)[Si](C)(C)C |
| InChI | InChI=1S/C20H44N2Si4/c1-23(2,3)21(24(4,5)6)17-19-14-13-15-20(16-19)18-22(25(7,8)9)26(10,11)12/h13-16H,17-18H2,1-12H3 |
| InChIKey | VEISNUVEGGAVQW-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.93 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|