C25H40ClNO3Si3 — CID 91697107
[4-[9-chloro-7,8-bis(trimethylsilyloxy)-2,3,4,5-tetrahydro-1H-3-benzazepin-5-yl]phenoxy]-trimethylsilane (PubChem CID 91697107) has the molecular formula C25H40ClNO3Si3 and a molecular weight of 522.31 g/mol. Its IUPAC name is [4-[9-chloro-7,8-bis(trimethylsilyloxy)-2,3,4,5-tetrahydro-1H-3-benzazepin-5-yl]phenoxy]-trimethylsilane.
| Compound Name | [4-[9-chloro-7,8-bis(trimethylsilyloxy)-2,3,4,5-tetrahydro-1H-3-benzazepin-5-yl]phenoxy]-trimethylsilane |
|---|---|
| PubChem CID | 91697107 |
| Molecular Formula | C25H40ClNO3Si3 |
| Molecular Weight | 522.31 g/mol |
| Exact Mass | 521.20 |
| IUPAC Name | [4-[9-chloro-7,8-bis(trimethylsilyloxy)-2,3,4,5-tetrahydro-1H-3-benzazepin-5-yl]phenoxy]-trimethylsilane |
| SMILES | C[Si](C)(C)Oc1ccc(C2CNCCc3c2cc(O[Si](C)(C)C)c(O[Si](C)(C)C)c3Cl)cc1 |
| InChI | InChI=1S/C25H40ClNO3Si3/c1-31(2,3)28-19-12-10-18(11-13-19)22-17-27-15-14-20-21(22)16-23(29-32(4,5)6)25(24(20)26)30-33(7,8)9/h10-13,16,22,27H,14-15,17H2,1-9H3 |
| InChIKey | GIKJDDCIQQOGDO-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.31 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|