C14H24N2OSi — CID 91697332
N'-[tert-butyl(dimethyl)silyl]oxy-3-methylbenzenecarboximidamide (PubChem CID 91697332) has the molecular formula C14H24N2OSi and a molecular weight of 264.44 g/mol. Its IUPAC name is N'-[tert-butyl(dimethyl)silyl]oxy-3-methylbenzenecarboximidamide.
| Compound Name | N'-[tert-butyl(dimethyl)silyl]oxy-3-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 91697332 |
| Molecular Formula | C14H24N2OSi |
| Molecular Weight | 264.44 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | N'-[tert-butyl(dimethyl)silyl]oxy-3-methylbenzenecarboximidamide |
| SMILES | Cc1cccc(/C(N)=N/O[Si](C)(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C14H24N2OSi/c1-11-8-7-9-12(10-11)13(15)16-17-18(5,6)14(2,3)4/h7-10H,1-6H3,(H2,15,16) |
| InChIKey | UXNPFRLBWWMHQD-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|