C13H16N2 — CID 91697608
2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-1-ylidene]propanedinitrile (PubChem CID 91697608) has the molecular formula C13H16N2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-1-ylidene]propanedinitrile.
| Compound Name | 2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 91697608 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-1-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1CCC[C@@H]2CCCC[C@H]12 |
| InChI | InChI=1S/C13H16N2/c14-8-11(9-15)13-7-3-5-10-4-1-2-6-12(10)13/h10,12H,1-7H2/t10-,12-/m0/s1 |
| InChIKey | OZCMSMWKYABZQU-JQWIXIFHSA-N |
| XLogP | 3.32 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|