C15H15N3O2S — CID 94855177
methyl (E)-2-cyano-3-[(1S)-2-(dicyanomethylidene)cyclohexyl]-3-methylsulfanylprop-2-enoate (PubChem CID 94855177) has the molecular formula C15H15N3O2S and a molecular weight of 301.37 g/mol. Its IUPAC name is methyl (E)-2-cyano-3-[(1S)-2-(dicyanomethylidene)cyclohexyl]-3-methylsulfanylprop-2-enoate.
| Compound Name | methyl (E)-2-cyano-3-[(1S)-2-(dicyanomethylidene)cyclohexyl]-3-methylsulfanylprop-2-enoate |
|---|---|
| PubChem CID | 94855177 |
| Molecular Formula | C15H15N3O2S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | methyl (E)-2-cyano-3-[(1S)-2-(dicyanomethylidene)cyclohexyl]-3-methylsulfanylprop-2-enoate |
| SMILES | COC(=O)/C(C#N)=C(/SC)[C@H]1CCCCC1=C(C#N)C#N |
| InChI | InChI=1S/C15H15N3O2S/c1-20-15(19)13(9-18)14(21-2)12-6-4-3-5-11(12)10(7-16)8-17/h12H,3-6H2,1-2H3/b14-13+/t12-/m0/s1 |
| InChIKey | PCJNNULWJLXCOW-FWJVZWRSSA-N |
| XLogP | 2.83 |
| TPSA | 97.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|