C20H24N2O4S — CID 27276428
methyl (Z)-2-cyano-3-[(1R,2E)-2-(1-cyano-2-ethoxy-2-oxoethylidene)-4,6,6-trimethylcyclohex-3-en-1-yl]-3-methylsulfanylprop-2-enoate (PubChem CID 27276428) has the molecular formula C20H24N2O4S and a molecular weight of 388.49 g/mol. Its IUPAC name is methyl (Z)-2-cyano-3-[(1R,2E)-2-(1-cyano-2-ethoxy-2-oxoethylidene)-4,6,6-trimethylcyclohex-3-en-1-yl]-3-methylsulfanylprop-2-enoate.
| Compound Name | methyl (Z)-2-cyano-3-[(1R,2E)-2-(1-cyano-2-ethoxy-2-oxoethylidene)-4,6,6-trimethylcyclohex-3-en-1-yl]-3-methylsulfanylprop-2-enoate |
|---|---|
| PubChem CID | 27276428 |
| Molecular Formula | C20H24N2O4S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | methyl (Z)-2-cyano-3-[(1R,2E)-2-(1-cyano-2-ethoxy-2-oxoethylidene)-4,6,6-trimethylcyclohex-3-en-1-yl]-3-methylsulfanylprop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C1\C=C(C)CC(C)(C)[C@H]1/C(SC)=C(\C#N)C(=O)OC |
| InChI | InChI=1S/C20H24N2O4S/c1-7-26-19(24)14(10-21)13-8-12(2)9-20(3,4)16(13)17(27-6)15(11-22)18(23)25-5/h8,16H,7,9H2,1-6H3/b14-13+,17-15-/t16-/m1/s1 |
| InChIKey | XPCYEMMPSAXSPB-NANXTMOZSA-N |
| XLogP | 3.68 |
| TPSA | 100.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|