C19H21N3O2S — CID 94855179
ethyl (Z)-2-cyano-3-[(1R)-2-(dicyanomethylidene)-4,6,6-trimethylcyclohex-3-en-1-yl]-3-methylsulfanylprop-2-enoate (PubChem CID 94855179) has the molecular formula C19H21N3O2S and a molecular weight of 355.46 g/mol. Its IUPAC name is ethyl (Z)-2-cyano-3-[(1R)-2-(dicyanomethylidene)-4,6,6-trimethylcyclohex-3-en-1-yl]-3-methylsulfanylprop-2-enoate.
| Compound Name | ethyl (Z)-2-cyano-3-[(1R)-2-(dicyanomethylidene)-4,6,6-trimethylcyclohex-3-en-1-yl]-3-methylsulfanylprop-2-enoate |
|---|---|
| PubChem CID | 94855179 |
| Molecular Formula | C19H21N3O2S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | ethyl (Z)-2-cyano-3-[(1R)-2-(dicyanomethylidene)-4,6,6-trimethylcyclohex-3-en-1-yl]-3-methylsulfanylprop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C(\SC)[C@H]1C(=C(C#N)C#N)C=C(C)CC1(C)C |
| InChI | InChI=1S/C19H21N3O2S/c1-6-24-18(23)15(11-22)17(25-5)16-14(13(9-20)10-21)7-12(2)8-19(16,3)4/h7,16H,6,8H2,1-5H3/b17-15-/t16-/m1/s1 |
| InChIKey | ZBGMXOQSMQVNMG-CFBLSMTOSA-N |
| XLogP | 4.03 |
| TPSA | 97.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|