methyl 4-(2,2,2-trifluoroacetyl)oxycyclohexane-1-carboxylate

C10H13F3O4 — CID 91697670

IUPACmethyl 4-(2,2,2-trifluoroacetyl)oxycyclohexane-1-carboxylate
SMILESCOC(=O)C1CCC(OC(=O)C(F)(F)F)CC1
InChIInChI=1S/C10H13F3O4/c1-16-8(14)6-2-4-7(5-3-6)17-9(15)10(11,12)13/h6-7H,2-5H2,1H3
InChIKeyGXLSAPLSZGHPOH-UHFFFAOYSA-N
MW254.20 g/mol
LogP1.82
Rot. Bonds2

About methyl 4-(2,2,2-trifluoroacetyl)oxycyclohexane-1-carboxylate

methyl 4-(2,2,2-trifluoroacetyl)oxycyclohexane-1-carboxylate (PubChem CID 91697670) has the molecular formula C10H13F3O4 and a molecular weight of 254.20 g/mol. Its IUPAC name is methyl 4-(2,2,2-trifluoroacetyl)oxycyclohexane-1-carboxylate.

Molecular Properties

Compound Namemethyl 4-(2,2,2-trifluoroacetyl)oxycyclohexane-1-carboxylate
PubChem CID91697670
Molecular FormulaC10H13F3O4
Molecular Weight254.20 g/mol
Exact Mass254.08
IUPAC Namemethyl 4-(2,2,2-trifluoroacetyl)oxycyclohexane-1-carboxylate
SMILESCOC(=O)C1CCC(OC(=O)C(F)(F)F)CC1
InChIInChI=1S/C10H13F3O4/c1-16-8(14)6-2-4-7(5-3-6)17-9(15)10(11,12)13/h6-7H,2-5H2,1H3
InChIKeyGXLSAPLSZGHPOH-UHFFFAOYSA-N
XLogP1.82
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500254.20
LogP ≤ 51.82
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 4-(2,2,2-trifluoroacetyl)oxycyclohexane-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(2,2,2-trifluoroacetyl)oxycyclohexane-1-carboxylate?
The IUPAC name of methyl 4-(2,2,2-trifluoroacetyl)oxycyclohexane-1-carboxylate (CID 91697670) is methyl 4-(2,2,2-trifluoroacetyl)oxycyclohexane-1-carboxylate.
What is the SMILES notation for methyl 4-(2,2,2-trifluoroacetyl)oxycyclohexane-1-carboxylate?
The canonical SMILES for methyl 4-(2,2,2-trifluoroacetyl)oxycyclohexane-1-carboxylate is COC(=O)C1CCC(OC(=O)C(F)(F)F)CC1.
What is the InChIKey of methyl 4-(2,2,2-trifluoroacetyl)oxycyclohexane-1-carboxylate?
The InChIKey is GXLSAPLSZGHPOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13F3O4/c1-16-8(14)6-2-4-7(5-3-6)17-9(15)10(11,12)13/h6-7H,2-5H2,1H3.
What are the key properties of methyl 4-(2,2,2-trifluoroacetyl)oxycyclohexane-1-carboxylate?
methyl 4-(2,2,2-trifluoroacetyl)oxycyclohexane-1-carboxylate has a molecular weight of 254.20 g/mol, XLogP of 1.82, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(2,2,2-trifluoroacetyl)oxycyclohexane-1-carboxylate is sourced from PubChem (CID 91697670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).