C20H31NO2Si — CID 91698910
N-methyl-3-naphthalen-1-yloxy-N-propan-2-yl-2-trimethylsilyloxypropan-1-amine (PubChem CID 91698910) has the molecular formula C20H31NO2Si and a molecular weight of 345.56 g/mol. Its IUPAC name is N-methyl-3-naphthalen-1-yloxy-N-propan-2-yl-2-trimethylsilyloxypropan-1-amine.
| Compound Name | N-methyl-3-naphthalen-1-yloxy-N-propan-2-yl-2-trimethylsilyloxypropan-1-amine |
|---|---|
| PubChem CID | 91698910 |
| Molecular Formula | C20H31NO2Si |
| Molecular Weight | 345.56 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | N-methyl-3-naphthalen-1-yloxy-N-propan-2-yl-2-trimethylsilyloxypropan-1-amine |
| SMILES | CC(C)N(C)CC(COc1cccc2ccccc12)O[Si](C)(C)C |
| InChI | InChI=1S/C20H31NO2Si/c1-16(2)21(3)14-18(23-24(4,5)6)15-22-20-13-9-11-17-10-7-8-12-19(17)20/h7-13,16,18H,14-15H2,1-6H3 |
| InChIKey | USXMPUIOKVEBIP-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.56 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|