About 4-methylpentyl 2-[2-oxo-2-(2-phenylethoxy)ethoxy]acetate
4-methylpentyl 2-[2-oxo-2-(2-phenylethoxy)ethoxy]acetate (PubChem CID 91703214) has the molecular formula C18H26O5
and a molecular weight of 322.40 g/mol. Its IUPAC name is 4-methylpentyl 2-[2-oxo-2-(2-phenylethoxy)ethoxy]acetate.
Molecular Properties
| Compound Name | 4-methylpentyl 2-[2-oxo-2-(2-phenylethoxy)ethoxy]acetate |
| PubChem CID | 91703214 |
| Molecular Formula | C18H26O5 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 4-methylpentyl 2-[2-oxo-2-(2-phenylethoxy)ethoxy]acetate |
| SMILES | CC(C)CCCOC(=O)COCC(=O)OCCc1ccccc1 |
| InChI | InChI=1S/C18H26O5/c1-15(2)7-6-11-22-17(19)13-21-14-18(20)23-12-10-16-8-4-3-5-9-16/h3-5,8-9,15H,6-7,10-14H2,1-2H3 |
| InChIKey | LEHYWCKTYWWALT-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-methylpentyl 2-[2-oxo-2-(2-phenylethoxy)ethoxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpentyl 2-[2-oxo-2-(2-phenylethoxy)ethoxy]acetate?
The IUPAC name of 4-methylpentyl 2-[2-oxo-2-(2-phenylethoxy)ethoxy]acetate (CID 91703214) is 4-methylpentyl 2-[2-oxo-2-(2-phenylethoxy)ethoxy]acetate.
What is the SMILES notation for 4-methylpentyl 2-[2-oxo-2-(2-phenylethoxy)ethoxy]acetate?
The canonical SMILES for 4-methylpentyl 2-[2-oxo-2-(2-phenylethoxy)ethoxy]acetate is CC(C)CCCOC(=O)COCC(=O)OCCc1ccccc1.
What is the InChIKey of 4-methylpentyl 2-[2-oxo-2-(2-phenylethoxy)ethoxy]acetate?
The InChIKey is LEHYWCKTYWWALT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26O5/c1-15(2)7-6-11-22-17(19)13-21-14-18(20)23-12-10-16-8-4-3-5-9-16/h3-5,8-9,15H,6-7,10-14H2,1-2H3.
What are the key properties of 4-methylpentyl 2-[2-oxo-2-(2-phenylethoxy)ethoxy]acetate?
4-methylpentyl 2-[2-oxo-2-(2-phenylethoxy)ethoxy]acetate has a molecular weight of 322.40 g/mol, XLogP of 2.77, 11 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpentyl 2-[2-oxo-2-(2-phenylethoxy)ethoxy]acetate is sourced from PubChem (CID 91703214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).