C23H32O4 — CID 91710003
2-O-(4-methylpentyl) 1-O-(3-phenylpropyl) cyclohex-4-ene-1,2-dicarboxylate (PubChem CID 91710003) has the molecular formula C23H32O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is 2-O-(4-methylpentyl) 1-O-(3-phenylpropyl) cyclohex-4-ene-1,2-dicarboxylate.
| Compound Name | 2-O-(4-methylpentyl) 1-O-(3-phenylpropyl) cyclohex-4-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 91710003 |
| Molecular Formula | C23H32O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | 2-O-(4-methylpentyl) 1-O-(3-phenylpropyl) cyclohex-4-ene-1,2-dicarboxylate |
| SMILES | CC(C)CCCOC(=O)C1CC=CCC1C(=O)OCCCc1ccccc1 |
| InChI | InChI=1S/C23H32O4/c1-18(2)10-8-16-26-22(24)20-14-6-7-15-21(20)23(25)27-17-9-13-19-11-4-3-5-12-19/h3-7,11-12,18,20-21H,8-10,13-17H2,1-2H3 |
| InChIKey | QPLRVZQHNVUEPP-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|