C26H38O4 — CID 140544792
1-O-(7-methyloctyl) 2-O-(1-phenylethyl) 4-methylcyclohex-4-ene-1,2-dicarboxylate (PubChem CID 140544792) has the molecular formula C26H38O4 and a molecular weight of 414.59 g/mol. Its IUPAC name is 1-O-(7-methyloctyl) 2-O-(1-phenylethyl) 4-methylcyclohex-4-ene-1,2-dicarboxylate.
| Compound Name | 1-O-(7-methyloctyl) 2-O-(1-phenylethyl) 4-methylcyclohex-4-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 140544792 |
| Molecular Formula | C26H38O4 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.28 |
| IUPAC Name | 1-O-(7-methyloctyl) 2-O-(1-phenylethyl) 4-methylcyclohex-4-ene-1,2-dicarboxylate |
| SMILES | CC1=CCC(C(=O)OCCCCCCC(C)C)C(C(=O)OC(C)c2ccccc2)C1 |
| InChI | InChI=1S/C26H38O4/c1-19(2)12-8-5-6-11-17-29-25(27)23-16-15-20(3)18-24(23)26(28)30-21(4)22-13-9-7-10-14-22/h7,9-10,13-15,19,21,23-24H,5-6,8,11-12,16-18H2,1-4H3 |
| InChIKey | ZKFNSJASBMRYRQ-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|