C18H26O5 — CID 91698814
4-methylpentyl 2-[2-(2,5-dimethylphenoxy)-2-oxoethoxy]acetate (PubChem CID 91698814) has the molecular formula C18H26O5 and a molecular weight of 322.40 g/mol. Its IUPAC name is 4-methylpentyl 2-[2-(2,5-dimethylphenoxy)-2-oxoethoxy]acetate.
| Compound Name | 4-methylpentyl 2-[2-(2,5-dimethylphenoxy)-2-oxoethoxy]acetate |
|---|---|
| PubChem CID | 91698814 |
| Molecular Formula | C18H26O5 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 4-methylpentyl 2-[2-(2,5-dimethylphenoxy)-2-oxoethoxy]acetate |
| SMILES | Cc1ccc(C)c(OC(=O)COCC(=O)OCCCC(C)C)c1 |
| InChI | InChI=1S/C18H26O5/c1-13(2)6-5-9-22-17(19)11-21-12-18(20)23-16-10-14(3)7-8-15(16)4/h7-8,10,13H,5-6,9,11-12H2,1-4H3 |
| InChIKey | NKGTXEPZAXTTLA-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|