C17H15N3O2 — CID 91703871
6,13-dimethyl-13aH-quinazolino[2,3-a]phthalazine-5,8-dione (PubChem CID 91703871) has the molecular formula C17H15N3O2 and a molecular weight of 293.33 g/mol. Its IUPAC name is 6,13-dimethyl-13aH-quinazolino[2,3-a]phthalazine-5,8-dione.
| Compound Name | 6,13-dimethyl-13aH-quinazolino[2,3-a]phthalazine-5,8-dione |
|---|---|
| PubChem CID | 91703871 |
| Molecular Formula | C17H15N3O2 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 6,13-dimethyl-13aH-quinazolino[2,3-a]phthalazine-5,8-dione |
| SMILES | CN1c2ccccc2C(=O)N2C1c1ccccc1C(=O)N2C |
| InChI | InChI=1S/C17H15N3O2/c1-18-14-10-6-5-9-13(14)17(22)20-15(18)11-7-3-4-8-12(11)16(21)19(20)2/h3-10,15H,1-2H3 |
| InChIKey | CYEJINHSGXBMHO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |