About 4-O-(2-ethylhexyl) 1-O-[(2-methylcyclohexen-1-yl)methyl] butanedioate
4-O-(2-ethylhexyl) 1-O-[(2-methylcyclohexen-1-yl)methyl] butanedioate (PubChem CID 91704262) has the molecular formula C20H34O4
and a molecular weight of 338.49 g/mol. Its IUPAC name is 4-O-(2-ethylhexyl) 1-O-[(2-methylcyclohexen-1-yl)methyl] butanedioate.
Molecular Properties
| Compound Name | 4-O-(2-ethylhexyl) 1-O-[(2-methylcyclohexen-1-yl)methyl] butanedioate |
| PubChem CID | 91704262 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | 4-O-(2-ethylhexyl) 1-O-[(2-methylcyclohexen-1-yl)methyl] butanedioate |
| SMILES | CCCCC(CC)COC(=O)CCC(=O)OCC1=C(C)CCCC1 |
| InChI | InChI=1S/C20H34O4/c1-4-6-10-17(5-2)14-23-19(21)12-13-20(22)24-15-18-11-8-7-9-16(18)3/h17H,4-15H2,1-3H3 |
| InChIKey | HCZTZWNTDLIZQI-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-O-(2-ethylhexyl) 1-O-[(2-methylcyclohexen-1-yl)methyl] butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-(2-ethylhexyl) 1-O-[(2-methylcyclohexen-1-yl)methyl] butanedioate?
The IUPAC name of 4-O-(2-ethylhexyl) 1-O-[(2-methylcyclohexen-1-yl)methyl] butanedioate (CID 91704262) is 4-O-(2-ethylhexyl) 1-O-[(2-methylcyclohexen-1-yl)methyl] butanedioate.
What is the SMILES notation for 4-O-(2-ethylhexyl) 1-O-[(2-methylcyclohexen-1-yl)methyl] butanedioate?
The canonical SMILES for 4-O-(2-ethylhexyl) 1-O-[(2-methylcyclohexen-1-yl)methyl] butanedioate is CCCCC(CC)COC(=O)CCC(=O)OCC1=C(C)CCCC1.
What is the InChIKey of 4-O-(2-ethylhexyl) 1-O-[(2-methylcyclohexen-1-yl)methyl] butanedioate?
The InChIKey is HCZTZWNTDLIZQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H34O4/c1-4-6-10-17(5-2)14-23-19(21)12-13-20(22)24-15-18-11-8-7-9-16(18)3/h17H,4-15H2,1-3H3.
What are the key properties of 4-O-(2-ethylhexyl) 1-O-[(2-methylcyclohexen-1-yl)methyl] butanedioate?
4-O-(2-ethylhexyl) 1-O-[(2-methylcyclohexen-1-yl)methyl] butanedioate has a molecular weight of 338.49 g/mol, XLogP of 4.96, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-(2-ethylhexyl) 1-O-[(2-methylcyclohexen-1-yl)methyl] butanedioate is sourced from PubChem (CID 91704262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).