C22H38O4 — CID 91694825
1-O-[(2E)-3,7-dimethylocta-2,6-dienyl] 4-O-(2-ethylhexyl) butanedioate (PubChem CID 91694825) has the molecular formula C22H38O4 and a molecular weight of 366.54 g/mol. Its IUPAC name is 1-O-[(2E)-3,7-dimethylocta-2,6-dienyl] 4-O-(2-ethylhexyl) butanedioate.
| Compound Name | 1-O-[(2E)-3,7-dimethylocta-2,6-dienyl] 4-O-(2-ethylhexyl) butanedioate |
|---|---|
| PubChem CID | 91694825 |
| Molecular Formula | C22H38O4 |
| Molecular Weight | 366.54 g/mol |
| Exact Mass | 366.28 |
| IUPAC Name | 1-O-[(2E)-3,7-dimethylocta-2,6-dienyl] 4-O-(2-ethylhexyl) butanedioate |
| SMILES | CCCCC(CC)COC(=O)CCC(=O)OC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C22H38O4/c1-6-8-12-20(7-2)17-26-22(24)14-13-21(23)25-16-15-19(5)11-9-10-18(3)4/h10,15,20H,6-9,11-14,16-17H2,1-5H3/b19-15+ |
| InChIKey | JRYFMNHVDFYNJA-XDJHFCHBSA-N |
| XLogP | 5.76 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.54 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|