About 1-O-[(2-methylcyclohexen-1-yl)methyl] 5-O-(2-methylpentan-3-yl) pentanedioate
1-O-[(2-methylcyclohexen-1-yl)methyl] 5-O-(2-methylpentan-3-yl) pentanedioate (PubChem CID 91704381) has the molecular formula C19H32O4
and a molecular weight of 324.46 g/mol. Its IUPAC name is 1-O-[(2-methylcyclohexen-1-yl)methyl] 5-O-(2-methylpentan-3-yl) pentanedioate.
Molecular Properties
| Compound Name | 1-O-[(2-methylcyclohexen-1-yl)methyl] 5-O-(2-methylpentan-3-yl) pentanedioate |
| PubChem CID | 91704381 |
| Molecular Formula | C19H32O4 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | 1-O-[(2-methylcyclohexen-1-yl)methyl] 5-O-(2-methylpentan-3-yl) pentanedioate |
| SMILES | CCC(OC(=O)CCCC(=O)OCC1=C(C)CCCC1)C(C)C |
| InChI | InChI=1S/C19H32O4/c1-5-17(14(2)3)23-19(21)12-8-11-18(20)22-13-16-10-7-6-9-15(16)4/h14,17H,5-13H2,1-4H3 |
| InChIKey | DTOFYLQVDMAUSC-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-O-[(2-methylcyclohexen-1-yl)methyl] 5-O-(2-methylpentan-3-yl) pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-[(2-methylcyclohexen-1-yl)methyl] 5-O-(2-methylpentan-3-yl) pentanedioate?
The IUPAC name of 1-O-[(2-methylcyclohexen-1-yl)methyl] 5-O-(2-methylpentan-3-yl) pentanedioate (CID 91704381) is 1-O-[(2-methylcyclohexen-1-yl)methyl] 5-O-(2-methylpentan-3-yl) pentanedioate.
What is the SMILES notation for 1-O-[(2-methylcyclohexen-1-yl)methyl] 5-O-(2-methylpentan-3-yl) pentanedioate?
The canonical SMILES for 1-O-[(2-methylcyclohexen-1-yl)methyl] 5-O-(2-methylpentan-3-yl) pentanedioate is CCC(OC(=O)CCCC(=O)OCC1=C(C)CCCC1)C(C)C.
What is the InChIKey of 1-O-[(2-methylcyclohexen-1-yl)methyl] 5-O-(2-methylpentan-3-yl) pentanedioate?
The InChIKey is DTOFYLQVDMAUSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32O4/c1-5-17(14(2)3)23-19(21)12-8-11-18(20)22-13-16-10-7-6-9-15(16)4/h14,17H,5-13H2,1-4H3.
What are the key properties of 1-O-[(2-methylcyclohexen-1-yl)methyl] 5-O-(2-methylpentan-3-yl) pentanedioate?
1-O-[(2-methylcyclohexen-1-yl)methyl] 5-O-(2-methylpentan-3-yl) pentanedioate has a molecular weight of 324.46 g/mol, XLogP of 4.57, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-[(2-methylcyclohexen-1-yl)methyl] 5-O-(2-methylpentan-3-yl) pentanedioate is sourced from PubChem (CID 91704381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).