About 5-O-(3-methylbutan-2-yl) 1-O-[(2-methylcyclohexen-1-yl)methyl] pentanedioate
5-O-(3-methylbutan-2-yl) 1-O-[(2-methylcyclohexen-1-yl)methyl] pentanedioate (PubChem CID 91704380) has the molecular formula C18H30O4
and a molecular weight of 310.43 g/mol. Its IUPAC name is 5-O-(3-methylbutan-2-yl) 1-O-[(2-methylcyclohexen-1-yl)methyl] pentanedioate.
Molecular Properties
| Compound Name | 5-O-(3-methylbutan-2-yl) 1-O-[(2-methylcyclohexen-1-yl)methyl] pentanedioate |
| PubChem CID | 91704380 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | 5-O-(3-methylbutan-2-yl) 1-O-[(2-methylcyclohexen-1-yl)methyl] pentanedioate |
| SMILES | CC1=C(COC(=O)CCCC(=O)OC(C)C(C)C)CCCC1 |
| InChI | InChI=1S/C18H30O4/c1-13(2)15(4)22-18(20)11-7-10-17(19)21-12-16-9-6-5-8-14(16)3/h13,15H,5-12H2,1-4H3 |
| InChIKey | CAKDGMSLMYFZON-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-O-(3-methylbutan-2-yl) 1-O-[(2-methylcyclohexen-1-yl)methyl] pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-O-(3-methylbutan-2-yl) 1-O-[(2-methylcyclohexen-1-yl)methyl] pentanedioate?
The IUPAC name of 5-O-(3-methylbutan-2-yl) 1-O-[(2-methylcyclohexen-1-yl)methyl] pentanedioate (CID 91704380) is 5-O-(3-methylbutan-2-yl) 1-O-[(2-methylcyclohexen-1-yl)methyl] pentanedioate.
What is the SMILES notation for 5-O-(3-methylbutan-2-yl) 1-O-[(2-methylcyclohexen-1-yl)methyl] pentanedioate?
The canonical SMILES for 5-O-(3-methylbutan-2-yl) 1-O-[(2-methylcyclohexen-1-yl)methyl] pentanedioate is CC1=C(COC(=O)CCCC(=O)OC(C)C(C)C)CCCC1.
What is the InChIKey of 5-O-(3-methylbutan-2-yl) 1-O-[(2-methylcyclohexen-1-yl)methyl] pentanedioate?
The InChIKey is CAKDGMSLMYFZON-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30O4/c1-13(2)15(4)22-18(20)11-7-10-17(19)21-12-16-9-6-5-8-14(16)3/h13,15H,5-12H2,1-4H3.
What are the key properties of 5-O-(3-methylbutan-2-yl) 1-O-[(2-methylcyclohexen-1-yl)methyl] pentanedioate?
5-O-(3-methylbutan-2-yl) 1-O-[(2-methylcyclohexen-1-yl)methyl] pentanedioate has a molecular weight of 310.43 g/mol, XLogP of 4.18, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-O-(3-methylbutan-2-yl) 1-O-[(2-methylcyclohexen-1-yl)methyl] pentanedioate is sourced from PubChem (CID 91704380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).