C16H23F3O4 — CID 91704240
1-O-[(2-methylcyclohexen-1-yl)methyl] 5-O-(1,1,1-trifluoropropan-2-yl) pentanedioate (PubChem CID 91704240) has the molecular formula C16H23F3O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is 1-O-[(2-methylcyclohexen-1-yl)methyl] 5-O-(1,1,1-trifluoropropan-2-yl) pentanedioate.
| Compound Name | 1-O-[(2-methylcyclohexen-1-yl)methyl] 5-O-(1,1,1-trifluoropropan-2-yl) pentanedioate |
|---|---|
| PubChem CID | 91704240 |
| Molecular Formula | C16H23F3O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 1-O-[(2-methylcyclohexen-1-yl)methyl] 5-O-(1,1,1-trifluoropropan-2-yl) pentanedioate |
| SMILES | CC1=C(COC(=O)CCCC(=O)OC(C)C(F)(F)F)CCCC1 |
| InChI | InChI=1S/C16H23F3O4/c1-11-6-3-4-7-13(11)10-22-14(20)8-5-9-15(21)23-12(2)16(17,18)19/h12H,3-10H2,1-2H3 |
| InChIKey | XJSGKRQDRAFMQI-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|