C16H18F7NO2 — CID 91715250
2,2,3,3,4,4,4-heptafluoro-N-[1-(4-methoxy-3-methylphenyl)propan-2-yl]-N-methylbutanamide (PubChem CID 91715250) has the molecular formula C16H18F7NO2 and a molecular weight of 389.31 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-N-[1-(4-methoxy-3-methylphenyl)propan-2-yl]-N-methylbutanamide.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-N-[1-(4-methoxy-3-methylphenyl)propan-2-yl]-N-methylbutanamide |
|---|---|
| PubChem CID | 91715250 |
| Molecular Formula | C16H18F7NO2 |
| Molecular Weight | 389.31 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-N-[1-(4-methoxy-3-methylphenyl)propan-2-yl]-N-methylbutanamide |
| SMILES | COc1ccc(CC(C)N(C)C(=O)C(F)(F)C(F)(F)C(F)(F)F)cc1C |
| InChI | InChI=1S/C16H18F7NO2/c1-9-7-11(5-6-12(9)26-4)8-10(2)24(3)13(25)14(17,18)15(19,20)16(21,22)23/h5-7,10H,8H2,1-4H3 |
| InChIKey | BXWUNVAHAZMXLF-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.31 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|