About (2-methyl-5-propan-2-ylcyclohexyl) octyl carbonate
(2-methyl-5-propan-2-ylcyclohexyl) octyl carbonate (PubChem CID 91715884) has the molecular formula C19H36O3
and a molecular weight of 312.49 g/mol. Its IUPAC name is (2-methyl-5-propan-2-ylcyclohexyl) octyl carbonate.
Molecular Properties
| Compound Name | (2-methyl-5-propan-2-ylcyclohexyl) octyl carbonate |
| PubChem CID | 91715884 |
| Molecular Formula | C19H36O3 |
| Molecular Weight | 312.49 g/mol |
| Exact Mass | 312.27 |
| IUPAC Name | (2-methyl-5-propan-2-ylcyclohexyl) octyl carbonate |
| SMILES | CCCCCCCCOC(=O)OC1CC(C(C)C)CCC1C |
| InChI | InChI=1S/C19H36O3/c1-5-6-7-8-9-10-13-21-19(20)22-18-14-17(15(2)3)12-11-16(18)4/h15-18H,5-14H2,1-4H3 |
| InChIKey | GEDINASAIOTDQQ-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.49 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2-methyl-5-propan-2-ylcyclohexyl) octyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-5-propan-2-ylcyclohexyl) octyl carbonate?
The IUPAC name of (2-methyl-5-propan-2-ylcyclohexyl) octyl carbonate (CID 91715884) is (2-methyl-5-propan-2-ylcyclohexyl) octyl carbonate.
What is the SMILES notation for (2-methyl-5-propan-2-ylcyclohexyl) octyl carbonate?
The canonical SMILES for (2-methyl-5-propan-2-ylcyclohexyl) octyl carbonate is CCCCCCCCOC(=O)OC1CC(C(C)C)CCC1C.
What is the InChIKey of (2-methyl-5-propan-2-ylcyclohexyl) octyl carbonate?
The InChIKey is GEDINASAIOTDQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H36O3/c1-5-6-7-8-9-10-13-21-19(20)22-18-14-17(15(2)3)12-11-16(18)4/h15-18H,5-14H2,1-4H3.
What are the key properties of (2-methyl-5-propan-2-ylcyclohexyl) octyl carbonate?
(2-methyl-5-propan-2-ylcyclohexyl) octyl carbonate has a molecular weight of 312.49 g/mol, XLogP of 5.96, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-5-propan-2-ylcyclohexyl) octyl carbonate is sourced from PubChem (CID 91715884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).