C22H25ClO4 — CID 91716173
4-O-[(4-chloro-2-methylphenyl)methyl] 1-O-hexyl benzene-1,4-dicarboxylate (PubChem CID 91716173) has the molecular formula C22H25ClO4 and a molecular weight of 388.89 g/mol. Its IUPAC name is 4-O-[(4-chloro-2-methylphenyl)methyl] 1-O-hexyl benzene-1,4-dicarboxylate.
| Compound Name | 4-O-[(4-chloro-2-methylphenyl)methyl] 1-O-hexyl benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 91716173 |
| Molecular Formula | C22H25ClO4 |
| Molecular Weight | 388.89 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 4-O-[(4-chloro-2-methylphenyl)methyl] 1-O-hexyl benzene-1,4-dicarboxylate |
| SMILES | CCCCCCOC(=O)c1ccc(C(=O)OCc2ccc(Cl)cc2C)cc1 |
| InChI | InChI=1S/C22H25ClO4/c1-3-4-5-6-13-26-21(24)17-7-9-18(10-8-17)22(25)27-15-19-11-12-20(23)14-16(19)2/h7-12,14H,3-6,13,15H2,1-2H3 |
| InChIKey | KFPBWZGRLHLOJI-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.89 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|