C21H16ClN3 — CID 917162
1-(4-chlorophenyl)-N-[3-(7-methylimidazo[1,2-a]pyridin-2-yl)phenyl]methanimine (PubChem CID 917162) has the molecular formula C21H16ClN3 and a molecular weight of 345.83 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[3-(7-methylimidazo[1,2-a]pyridin-2-yl)phenyl]methanimine.
| Compound Name | 1-(4-chlorophenyl)-N-[3-(7-methylimidazo[1,2-a]pyridin-2-yl)phenyl]methanimine |
|---|---|
| PubChem CID | 917162 |
| Molecular Formula | C21H16ClN3 |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[3-(7-methylimidazo[1,2-a]pyridin-2-yl)phenyl]methanimine |
| SMILES | Cc1ccn2cc(-c3cccc(/N=C/c4ccc(Cl)cc4)c3)nc2c1 |
| InChI | InChI=1S/C21H16ClN3/c1-15-9-10-25-14-20(24-21(25)11-15)17-3-2-4-19(12-17)23-13-16-5-7-18(22)8-6-16/h2-14H,1H3/b23-13+ |
| InChIKey | HWFMVFSRZDYHMA-YDZHTSKRSA-N |
| XLogP | 5.71 |
| TPSA | 29.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|