C17H28N2O5 — CID 91722480
prop-2-enyl 2-[2-(prop-2-enoxycarbonylamino)pentanoylamino]pentanoate (PubChem CID 91722480) has the molecular formula C17H28N2O5 and a molecular weight of 340.42 g/mol. Its IUPAC name is prop-2-enyl 2-[2-(prop-2-enoxycarbonylamino)pentanoylamino]pentanoate.
| Compound Name | prop-2-enyl 2-[2-(prop-2-enoxycarbonylamino)pentanoylamino]pentanoate |
|---|---|
| PubChem CID | 91722480 |
| Molecular Formula | C17H28N2O5 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | prop-2-enyl 2-[2-(prop-2-enoxycarbonylamino)pentanoylamino]pentanoate |
| SMILES | C=CCOC(=O)NC(CCC)C(=O)NC(CCC)C(=O)OCC=C |
| InChI | InChI=1S/C17H28N2O5/c1-5-9-13(19-17(22)24-12-8-4)15(20)18-14(10-6-2)16(21)23-11-7-3/h7-8,13-14H,3-6,9-12H2,1-2H3,(H,18,20)(H,19,22) |
| InChIKey | GIZIKHCUMAPGRC-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|