C16H12F8OSi — CID 91723473
dimethyl-(2,3,4,5,6-pentafluorophenyl)-[[4-(trifluoromethyl)phenyl]methoxy]silane (PubChem CID 91723473) has the molecular formula C16H12F8OSi and a molecular weight of 400.34 g/mol. Its IUPAC name is dimethyl-(2,3,4,5,6-pentafluorophenyl)-[[4-(trifluoromethyl)phenyl]methoxy]silane.
| Compound Name | dimethyl-(2,3,4,5,6-pentafluorophenyl)-[[4-(trifluoromethyl)phenyl]methoxy]silane |
|---|---|
| PubChem CID | 91723473 |
| Molecular Formula | C16H12F8OSi |
| Molecular Weight | 400.34 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | dimethyl-(2,3,4,5,6-pentafluorophenyl)-[[4-(trifluoromethyl)phenyl]methoxy]silane |
| SMILES | C[Si](C)(OCc1ccc(C(F)(F)F)cc1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C16H12F8OSi/c1-26(2,15-13(20)11(18)10(17)12(19)14(15)21)25-7-8-3-5-9(6-4-8)16(22,23)24/h3-6H,7H2,1-2H3 |
| InChIKey | GBFRWGPSOKRGOT-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.34 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|