C16H30N2O6 — CID 91723528
2-methylpropyl 2-[2-[2-methoxyethoxycarbonyl(methyl)amino]propanoyl-methylamino]propanoate (PubChem CID 91723528) has the molecular formula C16H30N2O6 and a molecular weight of 346.42 g/mol. Its IUPAC name is 2-methylpropyl 2-[2-[2-methoxyethoxycarbonyl(methyl)amino]propanoyl-methylamino]propanoate.
| Compound Name | 2-methylpropyl 2-[2-[2-methoxyethoxycarbonyl(methyl)amino]propanoyl-methylamino]propanoate |
|---|---|
| PubChem CID | 91723528 |
| Molecular Formula | C16H30N2O6 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | 2-methylpropyl 2-[2-[2-methoxyethoxycarbonyl(methyl)amino]propanoyl-methylamino]propanoate |
| SMILES | COCCOC(=O)N(C)C(C)C(=O)N(C)C(C)C(=O)OCC(C)C |
| InChI | InChI=1S/C16H30N2O6/c1-11(2)10-24-15(20)13(4)17(5)14(19)12(3)18(6)16(21)23-9-8-22-7/h11-13H,8-10H2,1-7H3 |
| InChIKey | VOUKWMINHVLGLA-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|