C15H9F3O2 — CID 91724220
9H-fluoren-9-yl 2,2,2-trifluoroacetate (PubChem CID 91724220) has the molecular formula C15H9F3O2 and a molecular weight of 278.23 g/mol. Its IUPAC name is 9H-fluoren-9-yl 2,2,2-trifluoroacetate.
| Compound Name | 9H-fluoren-9-yl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 91724220 |
| Molecular Formula | C15H9F3O2 |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 9H-fluoren-9-yl 2,2,2-trifluoroacetate |
| SMILES | O=C(OC1c2ccccc2-c2ccccc21)C(F)(F)F |
| InChI | InChI=1S/C15H9F3O2/c16-15(17,18)14(19)20-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13/h1-8,13H |
| InChIKey | GOXUPNQNOLJSDX-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |