C18H22ClN5O2 — CID 9172446
4-chloro-5-[methyl-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]amino]-2-phenylpyridazin-3-one (PubChem CID 9172446) has the molecular formula C18H22ClN5O2 and a molecular weight of 375.86 g/mol. Its IUPAC name is 4-chloro-5-[methyl-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]amino]-2-phenylpyridazin-3-one.
| Compound Name | 4-chloro-5-[methyl-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]amino]-2-phenylpyridazin-3-one |
|---|---|
| PubChem CID | 9172446 |
| Molecular Formula | C18H22ClN5O2 |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 4-chloro-5-[methyl-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]amino]-2-phenylpyridazin-3-one |
| SMILES | CN1CCN(C(=O)CN(C)c2cnn(-c3ccccc3)c(=O)c2Cl)CC1 |
| InChI | InChI=1S/C18H22ClN5O2/c1-21-8-10-23(11-9-21)16(25)13-22(2)15-12-20-24(18(26)17(15)19)14-6-4-3-5-7-14/h3-7,12H,8-11,13H2,1-2H3 |
| InChIKey | BICXDRMKYRHKLK-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 61.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |