C16H16ClN5O3 — CID 91725756
1-[7-chloro-6-methyl-3-[3-(4-nitrophenyl)propyl]pyrazolo[5,1-c][1,2,4]triazol-1-yl]ethanone (PubChem CID 91725756) has the molecular formula C16H16ClN5O3 and a molecular weight of 361.79 g/mol. Its IUPAC name is 1-[7-chloro-6-methyl-3-[3-(4-nitrophenyl)propyl]pyrazolo[5,1-c][1,2,4]triazol-1-yl]ethanone.
| Compound Name | 1-[7-chloro-6-methyl-3-[3-(4-nitrophenyl)propyl]pyrazolo[5,1-c][1,2,4]triazol-1-yl]ethanone |
|---|---|
| PubChem CID | 91725756 |
| Molecular Formula | C16H16ClN5O3 |
| Molecular Weight | 361.79 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 1-[7-chloro-6-methyl-3-[3-(4-nitrophenyl)propyl]pyrazolo[5,1-c][1,2,4]triazol-1-yl]ethanone |
| SMILES | CC(=O)n1nc(CCCc2ccc([N+](=O)[O-])cc2)n2nc(C)c(Cl)c12 |
| InChI | InChI=1S/C16H16ClN5O3/c1-10-15(17)16-20(11(2)23)19-14(21(16)18-10)5-3-4-12-6-8-13(9-7-12)22(24)25/h6-9H,3-5H2,1-2H3 |
| InChIKey | ILTHMESUGWFUIP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 95.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.79 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|