C24H33F5O4 — CID 91727718
1-O-decyl 3-O-[(2,3,4,5,6-pentafluorophenyl)methyl] 2,2-diethylpropanedioate (PubChem CID 91727718) has the molecular formula C24H33F5O4 and a molecular weight of 480.51 g/mol. Its IUPAC name is 1-O-decyl 3-O-[(2,3,4,5,6-pentafluorophenyl)methyl] 2,2-diethylpropanedioate.
| Compound Name | 1-O-decyl 3-O-[(2,3,4,5,6-pentafluorophenyl)methyl] 2,2-diethylpropanedioate |
|---|---|
| PubChem CID | 91727718 |
| Molecular Formula | C24H33F5O4 |
| Molecular Weight | 480.51 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | 1-O-decyl 3-O-[(2,3,4,5,6-pentafluorophenyl)methyl] 2,2-diethylpropanedioate |
| SMILES | CCCCCCCCCCOC(=O)C(CC)(CC)C(=O)OCc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C24H33F5O4/c1-4-7-8-9-10-11-12-13-14-32-22(30)24(5-2,6-3)23(31)33-15-16-17(25)19(27)21(29)20(28)18(16)26/h4-15H2,1-3H3 |
| InChIKey | IHORQARQPXXXSU-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.51 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|