C18H35NO4 — CID 91732925
4-methylpentyl 2-[2,2-dimethylpropoxycarbonyl(methyl)amino]-3-methylbutanoate (PubChem CID 91732925) has the molecular formula C18H35NO4 and a molecular weight of 329.48 g/mol. Its IUPAC name is 4-methylpentyl 2-[2,2-dimethylpropoxycarbonyl(methyl)amino]-3-methylbutanoate.
| Compound Name | 4-methylpentyl 2-[2,2-dimethylpropoxycarbonyl(methyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 91732925 |
| Molecular Formula | C18H35NO4 |
| Molecular Weight | 329.48 g/mol |
| Exact Mass | 329.26 |
| IUPAC Name | 4-methylpentyl 2-[2,2-dimethylpropoxycarbonyl(methyl)amino]-3-methylbutanoate |
| SMILES | CC(C)CCCOC(=O)C(C(C)C)N(C)C(=O)OCC(C)(C)C |
| InChI | InChI=1S/C18H35NO4/c1-13(2)10-9-11-22-16(20)15(14(3)4)19(8)17(21)23-12-18(5,6)7/h13-15H,9-12H2,1-8H3 |
| InChIKey | QEJZLYRROFTQIH-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.48 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|