C16H31NO4 — CID 91725908
4-methylpentyl 2-[2,2-dimethylpropoxycarbonyl(methyl)amino]propanoate (PubChem CID 91725908) has the molecular formula C16H31NO4 and a molecular weight of 301.43 g/mol. Its IUPAC name is 4-methylpentyl 2-[2,2-dimethylpropoxycarbonyl(methyl)amino]propanoate.
| Compound Name | 4-methylpentyl 2-[2,2-dimethylpropoxycarbonyl(methyl)amino]propanoate |
|---|---|
| PubChem CID | 91725908 |
| Molecular Formula | C16H31NO4 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.23 |
| IUPAC Name | 4-methylpentyl 2-[2,2-dimethylpropoxycarbonyl(methyl)amino]propanoate |
| SMILES | CC(C)CCCOC(=O)C(C)N(C)C(=O)OCC(C)(C)C |
| InChI | InChI=1S/C16H31NO4/c1-12(2)9-8-10-20-14(18)13(3)17(7)15(19)21-11-16(4,5)6/h12-13H,8-11H2,1-7H3 |
| InChIKey | KJGITFUBGMENTD-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|