C18H38O2Si — CID 91734905
ethenyl-heptoxy-methyl-(2,4,4-trimethylpentoxy)silane (PubChem CID 91734905) has the molecular formula C18H38O2Si and a molecular weight of 314.59 g/mol. Its IUPAC name is ethenyl-heptoxy-methyl-(2,4,4-trimethylpentoxy)silane.
| Compound Name | ethenyl-heptoxy-methyl-(2,4,4-trimethylpentoxy)silane |
|---|---|
| PubChem CID | 91734905 |
| Molecular Formula | C18H38O2Si |
| Molecular Weight | 314.59 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | ethenyl-heptoxy-methyl-(2,4,4-trimethylpentoxy)silane |
| SMILES | C=C[Si](C)(OCCCCCCC)OCC(C)CC(C)(C)C |
| InChI | InChI=1S/C18H38O2Si/c1-8-10-11-12-13-14-19-21(7,9-2)20-16-17(3)15-18(4,5)6/h9,17H,2,8,10-16H2,1,3-7H3 |
| InChIKey | OTQRLBBVTCZCFN-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.59 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|