C13H20N2OSi — CID 91735401
3-ethyl-4-trimethylsilyl-1,3-dihydroquinoxalin-2-one (PubChem CID 91735401) has the molecular formula C13H20N2OSi and a molecular weight of 248.40 g/mol. Its IUPAC name is 3-ethyl-4-trimethylsilyl-1,3-dihydroquinoxalin-2-one.
| Compound Name | 3-ethyl-4-trimethylsilyl-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 91735401 |
| Molecular Formula | C13H20N2OSi |
| Molecular Weight | 248.40 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 3-ethyl-4-trimethylsilyl-1,3-dihydroquinoxalin-2-one |
| SMILES | CCC1C(=O)Nc2ccccc2N1[Si](C)(C)C |
| InChI | InChI=1S/C13H20N2OSi/c1-5-11-13(16)14-10-8-6-7-9-12(10)15(11)17(2,3)4/h6-9,11H,5H2,1-4H3,(H,14,16) |
| InChIKey | KSZNCWQAKUOIKK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|