C20H17F3O2Si — CID 91736238
ethoxy-diphenyl-(2,3,4-trifluorophenoxy)silane (PubChem CID 91736238) has the molecular formula C20H17F3O2Si and a molecular weight of 374.43 g/mol. Its IUPAC name is ethoxy-diphenyl-(2,3,4-trifluorophenoxy)silane.
| Compound Name | ethoxy-diphenyl-(2,3,4-trifluorophenoxy)silane |
|---|---|
| PubChem CID | 91736238 |
| Molecular Formula | C20H17F3O2Si |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | ethoxy-diphenyl-(2,3,4-trifluorophenoxy)silane |
| SMILES | CCO[Si](Oc1ccc(F)c(F)c1F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H17F3O2Si/c1-2-24-26(15-9-5-3-6-10-15,16-11-7-4-8-12-16)25-18-14-13-17(21)19(22)20(18)23/h3-14H,2H2,1H3 |
| InChIKey | ANEUJYILVSMEPS-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|