C22H21F3O2Si — CID 91738933
butoxy-diphenyl-(2,3,4-trifluorophenoxy)silane (PubChem CID 91738933) has the molecular formula C22H21F3O2Si and a molecular weight of 402.49 g/mol. Its IUPAC name is butoxy-diphenyl-(2,3,4-trifluorophenoxy)silane.
| Compound Name | butoxy-diphenyl-(2,3,4-trifluorophenoxy)silane |
|---|---|
| PubChem CID | 91738933 |
| Molecular Formula | C22H21F3O2Si |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | butoxy-diphenyl-(2,3,4-trifluorophenoxy)silane |
| SMILES | CCCCO[Si](Oc1ccc(F)c(F)c1F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H21F3O2Si/c1-2-3-16-26-28(17-10-6-4-7-11-17,18-12-8-5-9-13-18)27-20-15-14-19(23)21(24)22(20)25/h4-15H,2-3,16H2,1H3 |
| InChIKey | BNYKVHDYVLCOQE-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|