C14H22N2OSi — CID 91739526
4,4-dimethyl-1-phenyl-2-trimethylsilylpyrazolidin-3-one (PubChem CID 91739526) has the molecular formula C14H22N2OSi and a molecular weight of 262.43 g/mol. Its IUPAC name is 4,4-dimethyl-1-phenyl-2-trimethylsilylpyrazolidin-3-one.
| Compound Name | 4,4-dimethyl-1-phenyl-2-trimethylsilylpyrazolidin-3-one |
|---|---|
| PubChem CID | 91739526 |
| Molecular Formula | C14H22N2OSi |
| Molecular Weight | 262.43 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 4,4-dimethyl-1-phenyl-2-trimethylsilylpyrazolidin-3-one |
| SMILES | CC1(C)CN(c2ccccc2)N([Si](C)(C)C)C1=O |
| InChI | InChI=1S/C14H22N2OSi/c1-14(2)11-15(12-9-7-6-8-10-12)16(13(14)17)18(3,4)5/h6-10H,11H2,1-5H3 |
| InChIKey | BBPIEXMEMJQVMP-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|