C10H23Cl2N2O2PSi — CID 91740850
N,N-bis(2-chloroethyl)-2-oxo-3-trimethylsilyl-1,3,2λ5-oxazaphosphinan-2-amine (PubChem CID 91740850) has the molecular formula C10H23Cl2N2O2PSi and a molecular weight of 333.27 g/mol. Its IUPAC name is N,N-bis(2-chloroethyl)-2-oxo-3-trimethylsilyl-1,3,2λ5-oxazaphosphinan-2-amine.
| Compound Name | N,N-bis(2-chloroethyl)-2-oxo-3-trimethylsilyl-1,3,2λ5-oxazaphosphinan-2-amine |
|---|---|
| PubChem CID | 91740850 |
| Molecular Formula | C10H23Cl2N2O2PSi |
| Molecular Weight | 333.27 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | N,N-bis(2-chloroethyl)-2-oxo-3-trimethylsilyl-1,3,2λ5-oxazaphosphinan-2-amine |
| SMILES | C[Si](C)(C)N1CCCOP1(=O)N(CCCl)CCCl |
| InChI | InChI=1S/C10H23Cl2N2O2PSi/c1-18(2,3)14-7-4-10-16-17(14,15)13(8-5-11)9-6-12/h4-10H2,1-3H3 |
| InChIKey | WIDLXISGVZIWAO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.27 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|